Products 852391-20-9
CAS 852391-20-9 appears in our catalog under these names: Necrostatin 2 S enantiomer, Necrostatin 2 S-Enantiomer, Necrostatin 2 (S enantiomer), 99.65%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 50 mg.
(5S)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione (CAS 852391-20-9) is a chemical compound with the molecular formula C13H12ClN3O2 and a molecular weight of 277.70 g/mol. IUPAC name: (5S)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione. InChIKey: WIKGAEMMNQTUGL-JTQLQIEISA-N.
| Molecular formula | C13H12ClN3O2 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | (5S)-5-[(7-chloro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione |
| InChIKey | WIKGAEMMNQTUGL-JTQLQIEISA-N |
| SMILES | CN1C(=O)[C@@H](NC1=O)CC2=CNC3=C2C=CC=C3Cl |
Computed by PubChem (NCBI)