CAS 85280-90-6 appears in our catalog under these names: 15(S)-15-methyl Prostaglandin D2, 15(S)–15–methyl Prostaglandin D2. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 500ug, 500μg, Get quote.
(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid (CAS 85280-90-6) is a chemical compound with the molecular formula C21H34O5 and a molecular weight of 366.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid. InChIKey: CTXLUMAOXBULOZ-QEQARHSSSA-N.
| Molecular formula | C21H34O5 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | CTXLUMAOXBULOZ-QEQARHSSSA-N |
| SMILES | CCCCC[C@@](C)(/C=C/[C@@H]1[C@H]([C@H](CC1=O)O)C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)