Products 97589-07-6
CAS 97589-07-6 appears in our catalog under these names: Lipoxin B4 methyl ester, Lipoxin B4 methyl ester. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 100μg, 25μg, 50μg, Get quote.
Methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyicosa-6,8,10,12-tetraenoate (CAS 97589-07-6) is a chemical compound with the molecular formula C21H34O5 and a molecular weight of 366.5 g/mol. IUPAC name: methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyicosa-6,8,10,12-tetraenoate. InChIKey: HXIJZYQKEFLJAL-BMNOQHBCSA-N.
| Molecular formula | C21H34O5 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyicosa-6,8,10,12-tetraenoate |
| InChIKey | HXIJZYQKEFLJAL-BMNOQHBCSA-N |
| SMILES | CCCCC[C@@H]([C@@H](/C=C/C=C/C=C\C=C\[C@H](CCCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)