Products 854405-75-7
CAS 854405-75-7 appears in our catalog under these names: 1-Methyl-1,4,5,6-tetrahydro-cyclopentapyrazole-3-carboxylic acid, 95%, 1-Methyl-1,4,5,6-tetrahydro-cyclopentapyrazole-3-carboxylic Acid, 1-Methyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid, 98%, 98%, 1-Methyl-1,4,5,6-tetrahydro-cyclopentapyrazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 0,5g, 100mg.
1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 854405-75-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: VJHXHXGIWYIILZ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | VJHXHXGIWYIILZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCC2)C(=N1)C(=O)O |
Computed by PubChem (NCBI)