Products 85477-04-9
CAS 85477-04-9 is the registry number for sodium 2,4-dimethoxybenzene-1-sulfinate, >95%. Offered by: Chemat. Available pack sizes: 100mg.
Sodium 2,4-dimethoxybenzenesulfinate (CAS 85477-04-9) is a chemical compound with the molecular formula C8H9NaO4S and a molecular weight of 224.21 g/mol. IUPAC name: sodium 2,4-dimethoxybenzenesulfinate. InChIKey: NVNPAMYRUFFLQJ-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO4S |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | sodium 2,4-dimethoxybenzenesulfinate |
| InChIKey | NVNPAMYRUFFLQJ-UHFFFAOYSA-M |
| SMILES | COC1=CC(=C(C=C1)S(=O)[O-])OC.[Na+] |
Computed by PubChem (NCBI)