Products 85484-42-0
CAS 85484-42-0 appears in our catalog under these names: 6,6'-Dimethyl-3,3'-bipyridine 95%, 6,6'-Dimethyl-3,3'-bipyridine, 95%, 95%, 6,6'-Dimethyl-3,3'-bipyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-methyl-5-(6-methyl-3-pyridinyl)pyridine (CAS 85484-42-0) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 2-methyl-5-(6-methyl-3-pyridinyl)pyridine. InChIKey: FLJBPXKTLWYFLG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2-methyl-5-(6-methyl-3-pyridinyl)pyridine |
| InChIKey | FLJBPXKTLWYFLG-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=CN=C(C=C2)C |
Computed by PubChem (NCBI)