CAS 854897-28-2 is the registry number for 6-Aminocinnolin-4-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-1H-cinnolin-4-one (CAS 854897-28-2) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 6-amino-1H-cinnolin-4-one. InChIKey: OBRLCWKNRMVRQQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-amino-1H-cinnolin-4-one |
| InChIKey | OBRLCWKNRMVRQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C=NN2 |
Computed by PubChem (NCBI)