CAS 85547-22-4 appears in our catalog under these names: Aaptamine, Aaptamine, 99.71%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 1mg, 500μg, 1 mg.
11,12-dimethoxy-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),3,5,7,9,11-hexaene (CAS 85547-22-4) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 11,12-dimethoxy-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),3,5,7,9,11-hexaene. InChIKey: IVXSXOFPZFVZTM-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 11,12-dimethoxy-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),3,5,7,9,11-hexaene |
| InChIKey | IVXSXOFPZFVZTM-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C3C(=C1)C=CN=C3C=CN2)OC |
Computed by PubChem (NCBI)