CAS 85553-55-5 is the registry number for (3-Pyrid-4-ylphenyl)methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
(3-pyridin-4-ylphenyl)methanol (CAS 85553-55-5) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (3-pyridin-4-ylphenyl)methanol. InChIKey: ZORHPGKUTIFODF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (3-pyridin-4-ylphenyl)methanol |
| InChIKey | ZORHPGKUTIFODF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=NC=C2)CO |
Computed by PubChem (NCBI)