Products 85563-65-1
CAS 85563-65-1 is the registry number for Sonderianol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4aR,10aS)-8-ethenyl-6-hydroxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (CAS 85563-65-1) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: (4aR,10aS)-8-ethenyl-6-hydroxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one. InChIKey: MWEHWEZBGQUQSJ-XLIONFOSSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (4aR,10aS)-8-ethenyl-6-hydroxy-1,1,4a,7-tetramethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| InChIKey | MWEHWEZBGQUQSJ-XLIONFOSSA-N |
| SMILES | CC1=C(C=C2C(=C1C=C)CC[C@H]3[C@]2(CCC(=O)C3(C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Sonderianol, orb1680521