CAS 855860-75-2 appears in our catalog under these names: N-(4-Aminophenyl)-2-chloro-n-methylacetamide, 95%, Nintedanib Impurity 28, Nintedanib Impurity 23. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin. Available pack sizes: 1g, 250mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(4-aminophenyl)-2-chloro-N-methylacetamide (CAS 855860-75-2) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: N-(4-aminophenyl)-2-chloro-N-methylacetamide. InChIKey: QEIHSYGISQYKFL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | N-(4-aminophenyl)-2-chloro-N-methylacetamide |
| InChIKey | QEIHSYGISQYKFL-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)N)C(=O)CCl |
Computed by PubChem (NCBI)