Products 855997-63-6
CAS 855997-63-6 appears in our catalog under these names: 2-Nitrobenzoic-d4 Acid, 98 atom % D, min 98% Chemical Purity, 2-Nitrobenzoic acid-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
2,3,4,5-tetradeuterio-6-nitrobenzoic acid (CAS 855997-63-6) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 171.14 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitrobenzoic acid. InChIKey: SLAMLWHELXOEJZ-RHQRLBAQSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-nitrobenzoic acid |
| InChIKey | SLAMLWHELXOEJZ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)