Products 856017-30-6
CAS 856017-30-6 is the registry number for 5-(1,1-Dimethylpropyl)-2-methoxybenzaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-methoxy-5-(2-methylbutan-2-yl)benzaldehyde (CAS 856017-30-6) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2-methoxy-5-(2-methylbutan-2-yl)benzaldehyde. InChIKey: AIVRXXIHBXCZPP-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-methoxy-5-(2-methylbutan-2-yl)benzaldehyde |
| InChIKey | AIVRXXIHBXCZPP-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)OC)C=O |
Computed by PubChem (NCBI)