CAS 85677-95-8 appears in our catalog under these names: Nicardipine Impurity 16, Nimodipine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-(2-hydroxyethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 85677-95-8) is a chemical compound with the molecular formula C18H20N2O7 and a molecular weight of 376.4 g/mol. IUPAC name: 5-O-(2-hydroxyethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: OFTWHTCEEWIQLZ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 5-O-(2-hydroxyethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | OFTWHTCEEWIQLZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCO)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)