Products 98318-09-3

CAS 98318-09-3 is the registry number for Ac-Glu(OSu)-OBzl. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamidopentanedioate (CAS 98318-09-3) is a chemical compound with the molecular formula C18H20N2O7 and a molecular weight of 376.4 g/mol. IUPAC name: 1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamidopentanedioate. InChIKey: WNMFDDLILCORIX-AWEZNQCLSA-N.

Identity
Molecular formulaC18H20N2O7
Molecular weight376.4 g/mol
IUPAC name1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-acetamidopentanedioate
InChIKeyWNMFDDLILCORIX-AWEZNQCLSA-N
SMILESCC(=O)N[C@@H](CCC(=O)ON1C(=O)CCC1=O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)