CAS 856835-53-5 appears in our catalog under these names: 4-Methyl-3-nitropyridine hydrochloride, 95%, 4–Methyl–3–nitropyridine hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 25g, 5g.
4-methyl-3-nitropyridine;hydrochloride (CAS 856835-53-5) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: 4-methyl-3-nitropyridine;hydrochloride. InChIKey: YJYIFDJCITXAAZ-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | 4-methyl-3-nitropyridine;hydrochloride |
| InChIKey | YJYIFDJCITXAAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)