Products 85700-55-6
CAS 85700-55-6 appears in our catalog under these names: Scopine HCl, Scopine Hydrochloride, Scopine Hydrochloride, >95% (HPLC), Scopine HCl, Scopine hydrochloride, 97%, 97%. Offered by: Chemat Brand, Mikromol, TRC, GLPBio, TargetMol. Available pack sizes: on request, 25mg, 1g, 250mg, 50mg, 100mg, 2mg, 2g.
(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol;hydrochloride (CAS 85700-55-6) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol;hydrochloride. InChIKey: BBBRAOXIMQHVCR-QYRWGYAXSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol;hydrochloride |
| InChIKey | BBBRAOXIMQHVCR-QYRWGYAXSA-N |
| SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)O.Cl |
Computed by PubChem (NCBI)