Products 857351-97-4
CAS 857351-97-4 appears in our catalog under these names: 2-Methyl-2-[3-(propan-2-yl)phenoxy]propanoic acid, 95%, 2-Methyl-2-(3-(propan-2-yl)phenoxy)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
2-methyl-2-(3-propan-2-ylphenoxy)propanoic acid (CAS 857351-97-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 2-methyl-2-(3-propan-2-ylphenoxy)propanoic acid. InChIKey: KOCDVPPXDKOJCG-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 2-methyl-2-(3-propan-2-ylphenoxy)propanoic acid |
| InChIKey | KOCDVPPXDKOJCG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)OC(C)(C)C(=O)O |
Computed by PubChem (NCBI)