Products 857363-49-6
CAS 857363-49-6 appears in our catalog under these names: 2,6-Dimethylisonicotinic acid hydrochloride, 95%, 2,6-Dimethylisonicotinic acid hydrochloride, 98+%, 2,6-dimethylisonicotinic acid hcl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
2,6-dimethylpyridine-4-carboxylic acid;hydrochloride (CAS 857363-49-6) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2,6-dimethylpyridine-4-carboxylic acid;hydrochloride. InChIKey: NRNDZQIVNNLXFN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2,6-dimethylpyridine-4-carboxylic acid;hydrochloride |
| InChIKey | NRNDZQIVNNLXFN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethylisonicotinic acid hydrochloride, 2,6-dimethylpyridine-4-carboxylic acid;hydrochloride, 2,6-dimethylpyridine-4-carboxylic acid hydrochloride, 2,6-Dimethylisonicotinic acid, HCl, NRNDZQIVNNLXFN-UHFFFAOYSA-N, 2,6-dimethyl-isonicotinic acid HCl salt, 2,6-Dimethylisonicotinicacidhydrochloride, 2,6-dimethyl-4-pyridine carboxylic acid hydrochloride, 2,6-Dimethylpyridine-4-carboxylic acid--hydrogen chloride (1/1)