CAS 857425-93-5 appears in our catalog under these names: 5-(tert-butyl)-3-((diethylamino)methyl)benzene-1,2-diol, 95%, 95%, 3-[(DIETHYLAMINO)METHYL]-5-(1,1-DIMETHYLETHYL)-1,2-BENZENEDIOL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-tert-butyl-3-(diethylaminomethyl)benzene-1,2-diol (CAS 857425-93-5) is a chemical compound with the molecular formula C15H25NO2 and a molecular weight of 251.36 g/mol. IUPAC name: 5-tert-butyl-3-(diethylaminomethyl)benzene-1,2-diol. InChIKey: RSTAAHIQJHBHGP-UHFFFAOYSA-N.
| Molecular formula | C15H25NO2 |
|---|---|
| Molecular weight | 251.36 g/mol |
| IUPAC name | 5-tert-butyl-3-(diethylaminomethyl)benzene-1,2-diol |
| InChIKey | RSTAAHIQJHBHGP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1=C(C(=CC(=C1)C(C)(C)C)O)O |
Computed by PubChem (NCBI)