Products 857764-71-7
CAS 857764-71-7 appears in our catalog under these names: 1-Phenyl-1H-imidazole-2-sulfonyl chloride, 98%, 98%, 1-Phenyl-1H-imidazole-2-sulfonyl chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-phenylimidazole-2-sulfonyl chloride (CAS 857764-71-7) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: 1-phenylimidazole-2-sulfonyl chloride. InChIKey: MKVVYHHBMLOFAH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | 1-phenylimidazole-2-sulfonyl chloride |
| InChIKey | MKVVYHHBMLOFAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CN=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)