Products 85785-00-8
CAS 85785-00-8 appears in our catalog under these names: N,N-Dimethylaniline-d11, N,N-Dimethylaniline-d11, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g.
2,3,4,5,6-pentadeuterio-N,N-bis(trideuteriomethyl)aniline (CAS 85785-00-8) is a chemical compound with the molecular formula C8H11N and a molecular weight of 132.25 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N,N-bis(trideuteriomethyl)aniline. InChIKey: JLTDJTHDQAWBAV-JFZRXOORSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 132.25 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-N,N-bis(trideuteriomethyl)aniline |
| InChIKey | JLTDJTHDQAWBAV-JFZRXOORSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)