Products 87385-38-4

CAS 87385-38-4 is the registry number for N,N-Dimethylaniline-2,3,4,5,6-d5, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

2,3,4,5,6-pentadeuterio-N,N-dimethylaniline (CAS 87385-38-4) is a chemical compound with the molecular formula C8H11N and a molecular weight of 126.21 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N,N-dimethylaniline. InChIKey: JLTDJTHDQAWBAV-DKFMXDSJSA-N.

Identity
Molecular formulaC8H11N
Molecular weight126.21 g/mol
IUPAC name2,3,4,5,6-pentadeuterio-N,N-dimethylaniline
InChIKeyJLTDJTHDQAWBAV-DKFMXDSJSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])N(C)C)[2H])[2H]

Computed by PubChem (NCBI)