CAS 858127-57-8 is the registry number for 1-Amino-1,5-dideoxy-L-erythro-2-pentulose. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
(3S,4S)-1-amino-3,4-dihydroxypentan-2-one (CAS 858127-57-8) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (3S,4S)-1-amino-3,4-dihydroxypentan-2-one. InChIKey: PPFTYFJBDQDNLS-UCORVYFPSA-N.
| Molecular formula | C5H11NO3 |
|---|---|
| Molecular weight | 133.15 g/mol |
| IUPAC name | (3S,4S)-1-amino-3,4-dihydroxypentan-2-one |
| InChIKey | PPFTYFJBDQDNLS-UCORVYFPSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)CN)O)O |
Computed by PubChem (NCBI)