CAS 858193-54-1 appears in our catalog under these names: 1,2,3-Trimethyl-1H-indol-5-ol, 95%, 1,2,3-Trimethyl-1H-indol-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,2,3-trimethylindol-5-ol (CAS 858193-54-1) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1,2,3-trimethylindol-5-ol. InChIKey: VXAIEZQYMTYPDN-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1,2,3-trimethylindol-5-ol |
| InChIKey | VXAIEZQYMTYPDN-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)C)C |
Computed by PubChem (NCBI)