CAS 858241-34-6 is the registry number for 4,6-Diamino-2-nitro-m-xylene. Offered by: Biosynth. Available pack sizes: 1000mg, 250mg, 2000mg, 5000mg.
4,6-dimethyl-5-nitrobenzene-1,3-diamine (CAS 858241-34-6) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 4,6-dimethyl-5-nitrobenzene-1,3-diamine. InChIKey: JZBIUSKLYGPDAP-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4,6-dimethyl-5-nitrobenzene-1,3-diamine |
| InChIKey | JZBIUSKLYGPDAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1N)N)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)