Products 858249-96-4

CAS 858249-96-4 is the registry number for 5-(Ethoxymethyl)furan-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

5-(ethoxymethyl)furan-2-carboxylic acid (CAS 858249-96-4) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 5-(ethoxymethyl)furan-2-carboxylic acid. InChIKey: WIVYCKXKKLJCNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4
Molecular weight170.16 g/mol
IUPAC name5-(ethoxymethyl)furan-2-carboxylic acid
InChIKeyWIVYCKXKKLJCNZ-UHFFFAOYSA-N
SMILESCCOCC1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)