CAS 858436-70-1 is the registry number for 2,6-Naphthalenedicarboxamidine, dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Naphthalene-2,6-dicarboximidamide;hydrochloride (CAS 858436-70-1) is a chemical compound with the molecular formula C12H13ClN4 and a molecular weight of 248.71 g/mol. IUPAC name: naphthalene-2,6-dicarboximidamide;hydrochloride. InChIKey: YUAWUAWVXOGHIT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4 |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | naphthalene-2,6-dicarboximidamide;hydrochloride |
| InChIKey | YUAWUAWVXOGHIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=N)N)C=C1C(=N)N.Cl |
Computed by PubChem (NCBI)