CAS 858490-11-6 is the registry number for 5-(tert-Butyl)-3-phenylisoxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-tert-butyl-3-phenyl-1,2-oxazole-4-carboxylic acid (CAS 858490-11-6) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 5-tert-butyl-3-phenyl-1,2-oxazole-4-carboxylic acid. InChIKey: LKAMSFDMBYTIHM-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 5-tert-butyl-3-phenyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | LKAMSFDMBYTIHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=NO1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)