Products 858491-87-9

CAS 858491-87-9 is the registry number for 4-Methyl-2-(2-phenylethyl)pentanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-methyl-2-(2-phenylethyl)pentanoic acid (CAS 858491-87-9) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 4-methyl-2-(2-phenylethyl)pentanoic acid. InChIKey: AHCWJXSPNYCXTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O2
Molecular weight220.31 g/mol
IUPAC name4-methyl-2-(2-phenylethyl)pentanoic acid
InChIKeyAHCWJXSPNYCXTQ-UHFFFAOYSA-N
SMILESCC(C)CC(CCC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)