CAS 85862-97-1 appears in our catalog under these names: 1-(3-(1H-1,2,3-Triazol-1-yl)phenyl)ethan-1-one, 1-(3-(1H-1,2,3-Triazol-1-yl)phenyl)ethan-1-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 5g.
1-[3-(triazol-1-yl)phenyl]ethanone (CAS 85862-97-1) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 1-[3-(triazol-1-yl)phenyl]ethanone. InChIKey: AEDNPNIFSJCYBF-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 1-[3-(triazol-1-yl)phenyl]ethanone |
| InChIKey | AEDNPNIFSJCYBF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2C=CN=N2 |
Computed by PubChem (NCBI)