Products 858679-51-3
CAS 858679-51-3 is the registry number for 2-((Pyrrolidin-1-yl)methyl)-1,3-benzoxazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-5-amine (CAS 858679-51-3) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 2-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-5-amine. InChIKey: JXEONDIXVBORTQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 2-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-5-amine |
| InChIKey | JXEONDIXVBORTQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)