CAS 85951-59-3 is the registry number for (6S)-6-Amino-5,6,7,8-tetrahydronaphthalen-1-ol. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
(6S)-6-amino-5,6,7,8-tetrahydronaphthalen-1-ol (CAS 85951-59-3) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (6S)-6-amino-5,6,7,8-tetrahydronaphthalen-1-ol. InChIKey: AUBNLLGXUCCYFZ-QMMMGPOBSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (6S)-6-amino-5,6,7,8-tetrahydronaphthalen-1-ol |
| InChIKey | AUBNLLGXUCCYFZ-QMMMGPOBSA-N |
| SMILES | C1CC2=C(C[C@H]1N)C=CC=C2O |
Computed by PubChem (NCBI)