Products 859979-73-0
CAS 859979-73-0 is the registry number for Ethyl 4-methoxy-3-methylbenzoylformate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-methoxy-3-methylphenyl)-2-oxoacetate (CAS 859979-73-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: ethyl 2-(4-methoxy-3-methylphenyl)-2-oxoacetate. InChIKey: RRLPISAPBOSKFR-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | ethyl 2-(4-methoxy-3-methylphenyl)-2-oxoacetate |
| InChIKey | RRLPISAPBOSKFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC(=C(C=C1)OC)C |
Computed by PubChem (NCBI)