CAS 860192-99-0 is the registry number for 5,7-Dibromoquinazolin-4(3H)-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5,7-dibromo-3H-quinazolin-4-one (CAS 860192-99-0) is a chemical compound with the molecular formula C8H4Br2N2O and a molecular weight of 303.94 g/mol. IUPAC name: 5,7-dibromo-3H-quinazolin-4-one. InChIKey: AHUPTGYCMWUAQI-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O |
|---|---|
| Molecular weight | 303.94 g/mol |
| IUPAC name | 5,7-dibromo-3H-quinazolin-4-one |
| InChIKey | AHUPTGYCMWUAQI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CNC2=O)Br)Br |
Computed by PubChem (NCBI)