CAS 875250-68-3 is the registry number for 3,6-Dibromocinnolin-4(1H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3,6-dibromo-1H-cinnolin-4-one (CAS 875250-68-3) is a chemical compound with the molecular formula C8H4Br2N2O and a molecular weight of 303.94 g/mol. IUPAC name: 3,6-dibromo-1H-cinnolin-4-one. InChIKey: SFAIGTYUAKKRGB-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2O |
|---|---|
| Molecular weight | 303.94 g/mol |
| IUPAC name | 3,6-dibromo-1H-cinnolin-4-one |
| InChIKey | SFAIGTYUAKKRGB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=NN2)Br |
Computed by PubChem (NCBI)