Products 860480-30-4
CAS 860480-30-4 appears in our catalog under these names: δ9–THCQ, Δ9-THCQ. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,4-dione (CAS 860480-30-4) is a chemical compound with the molecular formula C21H28O3 and a molecular weight of 328.4 g/mol. IUPAC name: (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,4-dione. InChIKey: KVAAAUWYXXYUQE-HZPDHXFCSA-N.
| Molecular formula | C21H28O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,4-dione |
| InChIKey | KVAAAUWYXXYUQE-HZPDHXFCSA-N |
| SMILES | CCCCCC1=CC(=O)C2=C(C1=O)OC([C@H]3[C@H]2C=C(CC3)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Delta9-THCQ, | currency9-THCQ