CAS 86071-23-0 is the registry number for J 2931. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,5-ditert-butyl-2-methoxy-3-[(4-methoxyphenyl)methyl]benzene (CAS 86071-23-0) is a chemical compound with the molecular formula C23H32O2 and a molecular weight of 340.5 g/mol. IUPAC name: 1,5-ditert-butyl-2-methoxy-3-[(4-methoxyphenyl)methyl]benzene. InChIKey: KBNPJLAIRDJCEU-UHFFFAOYSA-N.
| Molecular formula | C23H32O2 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | 1,5-ditert-butyl-2-methoxy-3-[(4-methoxyphenyl)methyl]benzene |
| InChIKey | KBNPJLAIRDJCEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)OC)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)