CAS 861446-16-4 appears in our catalog under these names: Resveratrol analog 1, 98%, Resveratrol analog 1, Resveratrol analog 1/ 98.42% (existing batch purity), Resveratrol analog 1, Resveratrol analog 1, 98.40%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 50 mg, 100 mg.
3-fluoro-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenol (CAS 861446-16-4) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 3-fluoro-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenol. InChIKey: HQRPEIZLSDDCOA-OWOJBTEDSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 3-fluoro-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenol |
| InChIKey | HQRPEIZLSDDCOA-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)F)O)O |
Computed by PubChem (NCBI)