Products 861673-67-8
CAS 861673-67-8 is the registry number for Pyridine, 2-[2-(1,1-dimethylethyl)phenoxy]-3-nitro-, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(2-tert-butylphenoxy)-3-nitropyridine (CAS 861673-67-8) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: 2-(2-tert-butylphenoxy)-3-nitropyridine. InChIKey: QSJUPCKYNOFKBT-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 2-(2-tert-butylphenoxy)-3-nitropyridine |
| InChIKey | QSJUPCKYNOFKBT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1OC2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)