CAS 861790-45-6 appears in our catalog under these names: N~2~-(9,10-dioxo-9,10-dihydro-2-anthracenyl)-2-pyridinecarboxamide, 95%, 95%, N-(9,10-Dihydro-9,10-dioxo-2-anthracenyl)-2-pyridinecarboxamide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg.
N-(9,10-dioxoanthracen-2-yl)pyridine-2-carboxamide (CAS 861790-45-6) is a chemical compound with the molecular formula C20H12N2O3 and a molecular weight of 328.3 g/mol. IUPAC name: N-(9,10-dioxoanthracen-2-yl)pyridine-2-carboxamide. InChIKey: KHNQYXNFGHDJEK-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O3 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | N-(9,10-dioxoanthracen-2-yl)pyridine-2-carboxamide |
| InChIKey | KHNQYXNFGHDJEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)NC(=O)C4=CC=CC=N4 |
Computed by PubChem (NCBI)