CAS 86187-86-2 appears in our catalog under these names: Imupedone/ 99.09% (existing batch purity), Methanone, (5-amino-2-(4-methyl-1-piperidinyl)phenyl)(4-chlorophenyl)-, LF 1695. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
[5-amino-2-(4-methylpiperidin-1-yl)phenyl]-(4-chlorophenyl)methanone (CAS 86187-86-2) is a chemical compound with the molecular formula C19H21ClN2O and a molecular weight of 328.8 g/mol. IUPAC name: [5-amino-2-(4-methylpiperidin-1-yl)phenyl]-(4-chlorophenyl)methanone. InChIKey: RTHJIPJVGHYRMG-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | [5-amino-2-(4-methylpiperidin-1-yl)phenyl]-(4-chlorophenyl)methanone |
| InChIKey | RTHJIPJVGHYRMG-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)N)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)