CAS 97716-04-6 is the registry number for 2-Chloro-10-(2-diethylaminoethyl)-9,10-dihydroacridin-9-one. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg, 100mg.
2-chloro-10-[2-(diethylamino)ethyl]acridin-9-one (CAS 97716-04-6) is a chemical compound with the molecular formula C19H21ClN2O and a molecular weight of 328.8 g/mol. IUPAC name: 2-chloro-10-[2-(diethylamino)ethyl]acridin-9-one. InChIKey: PEBZPKQLQNGHCL-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | 2-chloro-10-[2-(diethylamino)ethyl]acridin-9-one |
| InChIKey | PEBZPKQLQNGHCL-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)