Products 86248-24-0

CAS 86248-24-0 is the registry number for HEXANEDIOIC ACID, HEPTYL NONYL ESTER, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

1-O-heptyl 6-O-nonyl hexanedioate (CAS 86248-24-0) is a chemical compound with the molecular formula C22H42O4 and a molecular weight of 370.6 g/mol. IUPAC name: 1-O-heptyl 6-O-nonyl hexanedioate. InChIKey: DLZBUNUDESZERL-UHFFFAOYSA-N.

Identity
Molecular formulaC22H42O4
Molecular weight370.6 g/mol
IUPAC name1-O-heptyl 6-O-nonyl hexanedioate
InChIKeyDLZBUNUDESZERL-UHFFFAOYSA-N
SMILESCCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCC

Computed by PubChem (NCBI)