CAS 86270-92-0 appears in our catalog under these names: 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanone, NNK-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
N-(4-oxo-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide (CAS 86270-92-0) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 210.25 g/mol. IUPAC name: N-(4-oxo-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide. InChIKey: FLAQQSHRLBFIEZ-FIBGUPNXSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | N-(4-oxo-4-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide |
| InChIKey | FLAQQSHRLBFIEZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCC(=O)C1=CN=CC=C1)N=O |
Computed by PubChem (NCBI)