Products 863667-96-3

CAS 863667-96-3 is the registry number for 3-((3,4-Difluorophenyl)sulfanyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-(3,4-difluorophenyl)sulfanylpropanoic acid (CAS 863667-96-3) is a chemical compound with the molecular formula C9H8F2O2S and a molecular weight of 218.22 g/mol. IUPAC name: 3-(3,4-difluorophenyl)sulfanylpropanoic acid. InChIKey: OVLZSACZPZEUGH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O2S
Molecular weight218.22 g/mol
IUPAC name3-(3,4-difluorophenyl)sulfanylpropanoic acid
InChIKeyOVLZSACZPZEUGH-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1SCCC(=O)O)F)F

Computed by PubChem (NCBI)