Products 926213-05-0

CAS 926213-05-0 is the registry number for 2-((3,4-Difluorophenyl)sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(3,4-difluorophenyl)sulfanylpropanoic acid (CAS 926213-05-0) is a chemical compound with the molecular formula C9H8F2O2S and a molecular weight of 218.22 g/mol. IUPAC name: 2-(3,4-difluorophenyl)sulfanylpropanoic acid. InChIKey: PNNMSUWYKMPZJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O2S
Molecular weight218.22 g/mol
IUPAC name2-(3,4-difluorophenyl)sulfanylpropanoic acid
InChIKeyPNNMSUWYKMPZJP-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=CC(=C(C=C1)F)F

Computed by PubChem (NCBI)