CAS 926213-05-0 is the registry number for 2-((3,4-Difluorophenyl)sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,4-difluorophenyl)sulfanylpropanoic acid (CAS 926213-05-0) is a chemical compound with the molecular formula C9H8F2O2S and a molecular weight of 218.22 g/mol. IUPAC name: 2-(3,4-difluorophenyl)sulfanylpropanoic acid. InChIKey: PNNMSUWYKMPZJP-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2S |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)sulfanylpropanoic acid |
| InChIKey | PNNMSUWYKMPZJP-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)