Products 863870-73-9

CAS 863870-73-9 is the registry number for 3-IodophenylN,N-diethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(3-iodophenyl) N,N-diethylcarbamate (CAS 863870-73-9) is a chemical compound with the molecular formula C11H14INO2 and a molecular weight of 319.14 g/mol. IUPAC name: (3-iodophenyl) N,N-diethylcarbamate. InChIKey: HPCXIJSVERVGTI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14INO2
Molecular weight319.14 g/mol
IUPAC name(3-iodophenyl) N,N-diethylcarbamate
InChIKeyHPCXIJSVERVGTI-UHFFFAOYSA-N
SMILESCCN(CC)C(=O)OC1=CC(=CC=C1)I

Computed by PubChem (NCBI)