CAS 99540-20-2 is the registry number for 2-(2-Iodo-5-methoxyphenyl)-N,N-dimethylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-iodo-5-methoxyphenyl)-N,N-dimethylacetamide (CAS 99540-20-2) is a chemical compound with the molecular formula C11H14INO2 and a molecular weight of 319.14 g/mol. IUPAC name: 2-(2-iodo-5-methoxyphenyl)-N,N-dimethylacetamide. InChIKey: MCNOFYYFRXRROA-UHFFFAOYSA-N.
| Molecular formula | C11H14INO2 |
|---|---|
| Molecular weight | 319.14 g/mol |
| IUPAC name | 2-(2-iodo-5-methoxyphenyl)-N,N-dimethylacetamide |
| InChIKey | MCNOFYYFRXRROA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CC1=C(C=CC(=C1)OC)I |
Computed by PubChem (NCBI)