Products 864244-64-4
CAS 864244-64-4 appears in our catalog under these names: {((4-fluorophenyl)methyl)carbamoyl}formic Acid, 2-((4-Fluorobenzyl)amino)-2-Oxoacetic Acid. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 500mg, 0,5g, 50mg, on request.
2-[(4-fluorophenyl)methylamino]-2-oxoacetic acid (CAS 864244-64-4) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 2-[(4-fluorophenyl)methylamino]-2-oxoacetic acid. InChIKey: DXXSNUKDTVZDGU-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methylamino]-2-oxoacetic acid |
| InChIKey | DXXSNUKDTVZDGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
{[(4-fluorophenyl)methyl]carbamoyl}formic acid, 2-[(4-fluorophenyl)methylamino]-2-oxoacetic acid, Acetic acid, 2-[[(4-fluorophenyl)methyl]amino]-2-oxo-, Raltegravir Oxidative Impurity, {[(4-fluorophenyl)methyl]carbamoyl}formicacid, 2-[(4-fluorophenyl)methylamino]-2-oxo-acetic acid, 2-[[(4-Fluorophenyl)methyl]amino]-2-oxoacetic acid